L-Valine benzyl ester 4-toluenesulfonate
Catalog No: FT-0628056
CAS No: 16652-76-9
- Chemical Name: L-Valine benzyl ester 4-toluenesulfonate
- Molecular Formula: C19H25NO5S
- Molecular Weight: 379.5
- InChI Key: QWUQVUDPBXFOKF-MERQFXBCSA-N
- InChI: InChI=1S/C12H17NO2.C7H8O3S/c1-9(2)11(13)12(14)15-8-10-6-4-3-5-7-10;1-6-2-4-7(5-3-6)11(8,9)10/h3-7,9,11H,8,13H2,1-2H3;2-5H,1H3,(H,8,9,10)/t11-;/m0./s1
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | L-Valine benzyl ester p-toluenesulfonate salt |
|---|---|
| Flash_Point: | 160-162°C |
| Melting_Point: | 160-162 °C |
| FW: | 379.470 |
| Density: | N/A |
| CAS: | 16652-76-9 |
| Bolling_Point: | 160-162°C |
| MF: | C19H25NO5S |
| LogP: | 4.73590 |
|---|---|
| Flash_Point: | 160-162°C |
| FW: | 379.470 |
| Bolling_Point: | 160-162°C |
| Melting_Point: | 160-162 °C |
| PSA: | 115.07000 |
| MF: | C19H25NO5S |
| More_Info: | ['1. Appearance Unknow ', '2. Density(g/mL,25/4℃)Unknow ', '3. Relative vapor density(g/mL,Atmosphere =1)Unknow ', '4. Melting point(ºC)160-162°C5. Boiling point(ºC,Atmospheric pressure)160-162°C6. Boiling point(ºC,52kPa)Unknow ', '7. Refractive indexUnknow ', '8. Flash point(ºC)160-162°C ', '9. Specific rotation(º)-37 º (c=32% in methanol)10. Spontaneous ignition point or ignition temperature(ºC)Unknow ', '11. Vapor pressure(kPa,25ºC)Unknow ', '12. Saturated vapor pressure(kPa,60ºC)Unknow ', '13. Combustion heat(KJ/mol)Unknow ', '14. Critical temperature(ºC)Unknow ', '15. Critical pressure(KPa)Unknow ', '16. Oil-water(Octanol /Water )Logarithmic Value of Distribution Coefficient Unknow ', '17. Upper limit of explosion(%,V/V)Unknow ', '18. Lower limit of explosion(%,V/V)Unknow ', '19. Solubility Unknow'] |
| Vapor_Pressure: | 0.0028mmHg at 25°C |
| Exact_Mass: | 379.145355 |
| Personal_Protective_Equipment: | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2922499990 |
| WGK_Germany: | 3 |
| Safety_Statements: | S22-S24/25 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-